| Name | 2-(Methylthio)aniline |
| Synonyms | methioaniline o-Methioaniline 2-aminothioanisole 2-(Methylthio)aniline 2-methylsulfanylaniline 2-(methylmercapto)aniline Methyl 2-aminophenyl sulfide 2-Aminophenyl methyl sulfide 2-(Methylmercapto)aniline, 2-Aminothioanisole 5-(2,6-DIFLUOROPHENYL)-2-(TRIFLUOROMETHYL)-3-FUROYL CHLORIDE |
| CAS | 2987-53-3 |
| EINECS | 221-055-9 |
| InChI | InChI=1/C7H9NS/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3 |
| Molecular Formula | C7H9NS |
| Molar Mass | 139.22 |
| Density | 1.111g/mLat 25°C(lit.) |
| Melting Point | 215 °C |
| Boling Point | 234°C(lit.) |
| Flash Point | >230°F |
| Water Solubility | Soluble in water (less). |
| Vapor Presure | 0.052mmHg at 25°C |
| Appearance | Powder and/or Chunks |
| Specific Gravity | 1.111 |
| Color | White to light beige |
| BRN | 386211 |
| pKa | 3.45(at 25℃) |
| Storage Condition | Room Temprature |
| Refractive Index | n20/D 1.624(lit.) |
| MDL | MFCD00007708 |
| Physical and Chemical Properties | Yellow liquid. |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CY1138333 |
| FLUKA BRAND F CODES | 2-8-10-13 |
| HS Code | 29309090 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |